![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| beatmeinmoscow.mod | 2008-07-06 21:12 | 722K | |
| binaryrelations.mod | 2008-07-06 21:12 | 690K | |
| dims8modver.mod | 2008-07-06 21:12 | 50K | |
| disko1.mod | 2008-07-06 21:12 | 153K | |
| downonthedeck.mod | 2008-07-06 21:12 | 173K | |
| du lugter af sohest.mod | 2018-01-02 16:34 | 219K | |
| ego.mod | 2008-07-06 21:13 | 56K | |
| electrodelica.mod | 2008-07-06 21:13 | 805K | |
| fis i kasketten.mod | 2008-07-06 21:13 | 367K | |
| fuckregnormene.mod | 2008-07-06 21:13 | 892K | |
| goodbymetal.mod | 2008-07-06 21:13 | 337K | |
| guld-1pat.mod | 2008-07-06 21:13 | 541K | |
| horny.mod | 2023-06-03 07:29 | 638K | |
| hundisnor.mod | 2018-01-02 16:34 | 471K | |
| jullerupferrycity.mod | 2008-07-06 21:13 | 562K | |
| mind dirt.mod | 2008-07-06 21:13 | 118K | |
| musicsoundsbetterwit.mod | 2023-06-03 07:29 | 402K | |
| my shoe is barking.mod | 2008-07-06 21:13 | 259K | |
| old people on amphet.mod | 2008-07-06 21:13 | 152K | |
| psycho-active.mod | 2008-07-06 21:13 | 856K | |
| puk in the nazi dwar.mod | 2008-07-06 21:13 | 1.2M | |
| respekt for profeter.mod | 2008-07-06 21:13 | 543K | |
| should turn to b.mod | 2008-07-06 21:13 | 233K | |
| starting a new life-.mod | 2008-07-06 21:13 | 258K | |
| super-drug.mod | 2008-07-06 21:13 | 872K | |
| the innocent rubberd.mod | 2008-07-06 21:13 | 226K | |
| tripping on sunshine.mod | 2008-07-06 21:13 | 208K | |
| turnaround.mod | 2023-06-03 07:29 | 736K | |
| unnamed.mod | 2008-07-06 21:13 | 417K | |
| waiting for the sun.mod | 2008-07-06 21:13 | 169K | |
| when people dissapea.mod | 2008-07-06 21:13 | 250K | |