![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/unknown.gif) | zombie paper.spc | 2019-08-17 06:50 | 65K | |
| you win!.spc | 2019-08-17 06:50 | 65K | |
| your sanctuary - rainy circle.spc | 2019-08-17 06:50 | 65K | |
| your sanctuary - pink cloud.spc | 2019-08-17 06:50 | 65K | |
| your sanctuary - milky well.spc | 2019-08-17 06:50 | 65K | |
| your sanctuary - magnet hill.spc | 2019-08-17 06:50 | 65K | |
| your sanctuary - lumine hall.spc | 2019-08-17 06:50 | 65K | |
| your sanctuary - lilliput steps.spc | 2019-08-17 06:50 | 65K | |
| your sanctuary - giant step.spc | 2019-08-17 06:50 | 65K | |
| your sanctuary - fire spring.spc | 2019-08-17 06:50 | 65K | |
| your name, please.spc | 2019-08-17 06:50 | 65K | |
| your name, please (noiseless).spc | 2019-08-17 06:50 | 65K | |
| you gained a level!.spc | 2019-08-17 06:50 | 65K | |
| you defeated the boss!.spc | 2019-08-17 06:50 | 65K | |
| you've got a new friend!.spc | 2019-08-17 06:50 | 65K | |
| you've come far, ness.spc | 2019-08-17 06:50 | 65K | |
| winters white.spc | 2019-08-17 06:50 | 65K | |
| winters wake up call.spc | 2019-08-17 06:50 | 65K | |
| whoops!.spc | 2019-08-17 06:50 | 65K | |
| whoa!.spc | 2019-08-17 06:50 | 65K | |
| what an annoying knock!.spc | 2019-08-17 06:50 | 65K | |
| what a great picture!.spc | 2019-08-17 06:50 | 65K | |
| welcome to your sanctuary.spc | 2019-08-17 06:50 | 65K | |
| welcome home.spc | 2019-08-17 06:50 | 65K | |
| venus live!.spc | 2019-08-17 06:50 | 65K | |
| unused pokey jingle.spc | 2019-08-17 06:50 | 65K | |
| unknown jingle 2.spc | 2019-08-17 06:50 | 65K | |
| unknown jingle 1.spc | 2019-08-17 06:50 | 65K | |
| unidentified falling object.spc | 2019-08-17 06:50 | 65K | |
| topolla theatre, home to the one & only venus.spc | 2019-08-17 06:50 | 65K | |
| title screen.spc | 2019-08-17 06:50 | 65K | |
| threed, zombie central.spc | 2019-08-17 06:50 | 65K | |
| threed, free at last.spc | 2019-08-17 06:50 | 65K | |
| the voyage continues.spc | 2019-08-17 06:50 | 65K | |
| the unforgiving desert.spc | 2019-08-17 06:50 | 65K | |
| the tendas' cave.spc | 2019-08-17 06:50 | 65K | |
| the submarine.spc | 2019-08-17 06:50 | 65K | |
| the sphinx's puzzle solved!.spc | 2019-08-17 06:50 | 65K | |
| the sphinx's puzzle 5.spc | 2019-08-17 06:50 | 65K | |
| the sphinx's puzzle 4.spc | 2019-08-17 06:50 | 65K | |
| the sphinx's puzzle 3.spc | 2019-08-17 06:50 | 65K | |
| the sphinx's puzzle 2.spc | 2019-08-17 06:50 | 65K | |
| the sphinx's puzzle 1.spc | 2019-08-17 06:50 | 65K | |
| the sky runner.spc | 2019-08-17 06:50 | 65K | |
| the power.spc | 2019-08-17 06:50 | 65K | |
| the place.spc | 2019-08-17 06:50 | 65K | |
| the nightmare begins....spc | 2019-08-17 06:50 | 65K | |
| the monkeys' maze.spc | 2019-08-17 06:50 | 65K | |
| the metropolis of fourside.spc | 2019-08-17 06:50 | 65K | |
| the lost underworld.spc | 2019-08-17 06:50 | 65K | |
| the jolly flying man.spc | 2019-08-17 06:50 | 65K | |
| the heroes return (part 2).spc | 2019-08-17 06:50 | 65K | |
| the heroes return (part 1).spc | 2019-08-17 06:50 | 65K | |
| the floating kingdom of dalaam.spc | 2019-08-17 06:50 | 65K | |
| the evil giygas attacks! (part 2).spc | 2019-08-17 06:50 | 65K | |
| the evil giygas attacks! (part 1).spc | 2019-08-17 06:50 | 65K | |
| the deep darkness.spc | 2019-08-17 06:50 | 65K | |
| the cliff that time forgot.spc | 2019-08-17 06:50 | 65K | |
| that was easy!.spc | 2019-08-17 06:50 | 65K | |
| tessie has been sighted!.spc | 2019-08-17 06:50 | 65K | |
| tessie!.spc | 2019-08-17 06:50 | 65K | |
| teleportation end.spc | 2019-08-17 06:50 | 65K | |
| teleportation.spc | 2019-08-17 06:50 | 65K | |
| super dry dance.spc | 2019-08-17 06:50 | 65K | |
| sunrise & onett theme.spc | 2019-08-17 06:50 | 65K | |
| summers, eternal tourist trap.spc | 2019-08-17 06:50 | 65K | |
| stonehenge base shuts down.spc | 2019-08-17 06:50 | 65K | |
| spooky.spc | 2019-08-17 06:50 | 65K | |
| spell learned.spc | 2019-08-17 06:50 | 65K | |
| spacetoneer.spc | 2019-08-17 06:50 | 65K | |
| sound stone - rainy circle.spc | 2019-08-17 06:50 | 65K | |
| sound stone - rainy circle (complete).spc | 2019-08-17 06:50 | 65K | |
| sound stone - pink cloud.spc | 2019-08-17 06:50 | 65K | |
| sound stone - pink cloud (complete).spc | 2019-08-17 06:50 | 65K | |
| sound stone - no sounds.spc | 2019-08-17 06:50 | 65K | |
| sound stone - no sounds (complete).spc | 2019-08-17 06:50 | 65K | |
| sound stone - milky well.spc | 2019-08-17 06:50 | 65K | |
| sound stone - milky well (complete).spc | 2019-08-17 06:50 | 65K | |
| sound stone - magnet hill.spc | 2019-08-17 06:50 | 65K | |
| sound stone - magnet hill (complete).spc | 2019-08-17 06:50 | 65K | |
| sound stone - lumine hall.spc | 2019-08-17 06:50 | 65K | |
| sound stone - lumine hall (complete).spc | 2019-08-17 06:50 | 65K | |
| sound stone - lilliput steps.spc | 2019-08-17 06:50 | 65K | |
| sound stone - lilliput steps (complete).spc | 2019-08-17 06:50 | 65K | |
| sound stone - giant step.spc | 2019-08-17 06:50 | 65K | |
| sound stone - giant step (complete).spc | 2019-08-17 06:50 | 65K | |
| sound stone - fire spring.spc | 2019-08-17 06:50 | 65K | |
| sound stone - fire spring (complete).spc | 2019-08-17 06:50 | 65K | |
| someone's knocking at the door.spc | 2019-08-17 06:50 | 65K | |
| snowman.spc | 2019-08-17 06:50 | 65K | |
| smiles and tears.spc | 2019-08-17 06:50 | 65K | |
| secret passage.spc | 2019-08-17 06:50 | 65K | |
| sea of eden.spc | 2019-08-17 06:50 | 65K | |
| save the miners!.spc | 2019-08-17 06:50 | 65K | |
| saturn valley caverns.spc | 2019-08-17 06:50 | 65K | |
| sanctuary guardian.spc | 2019-08-17 06:50 | 65K | |
| sanctuary guardian's challenge.spc | 2019-08-17 06:50 | 65K | |
| sailing to scaraba.spc | 2019-08-17 06:50 | 65K | |
| runaway five to the rescue!.spc | 2019-08-17 06:50 | 65K | |
| runaway five on the move!.spc | 2019-08-17 06:50 | 65K | |
| runaway five left the building!.spc | 2019-08-17 06:50 | 65K | |
| runaway five - the daily show.spc | 2019-08-17 06:50 | 65K | |
| runaway five's final performance.spc | 2019-08-17 06:50 | 65K | |
| rude awakening.spc | 2019-08-17 06:50 | 65K | |
| rough landing.spc | 2019-08-17 06:50 | 65K | |
| pyramid.spc | 2019-08-17 06:50 | 65K | |
| prayer for safety.spc | 2019-08-17 06:50 | 65K | |
| pokey means business!.spc | 2019-08-17 06:50 | 65K | |
| pokey.spc | 2019-08-17 06:50 | 65K | |
| pokey's house.spc | 2019-08-17 06:50 | 65K | |
| pokey's house (buzz buzz).spc | 2019-08-17 06:50 | 65K | |
| pink cloud shrine.spc | 2019-08-17 06:50 | 65K | |
| phone.spc | 2019-08-17 06:50 | 65K | |
| phase distorter success.spc | 2019-08-17 06:50 | 65K | |
| phase distorter failed.spc | 2019-08-17 06:50 | 65K | |
| peaceful rest valley.spc | 2019-08-17 06:50 | 65K | |
| paula's theme.spc | 2019-08-17 06:50 | 65K | |
| otherworldly foe.spc | 2019-08-17 06:50 | 65K | |
| opening credits.spc | 2019-08-17 06:50 | 65K | |
| onett theme.spc | 2019-08-17 06:50 | 65K | |
| onett night 3.spc | 2019-08-17 06:50 | 65K | |
| onett night 2.spc | 2019-08-17 06:50 | 65K | |
| onett night 1.spc | 2019-08-17 06:50 | 65K | |
| onett buzz buzz 3.spc | 2019-08-17 06:50 | 65K | |
| onett buzz buzz 2.spc | 2019-08-17 06:50 | 65K | |
| onett buzz buzz 1.spc | 2019-08-17 06:50 | 65K | |
| onett's trumpet player.spc | 2019-08-17 06:50 | 65K | |
| onett's arcade.spc | 2019-08-17 06:50 | 65K | |
| one fateful night.spc | 2019-08-17 06:50 | 65K | |
| oncoming foe.spc | 2019-08-17 06:50 | 65K | |
| oncoming boss.spc | 2019-08-17 06:50 | 65K | |
| ok 'ssuka.spc | 2019-08-17 06:50 | 65K | |
| now, let's go!.spc | 2019-08-17 06:50 | 65K | |
| ness awakens from the nightmare.spc | 2019-08-17 06:50 | 65K | |
| ness' bike.spc | 2019-08-17 06:50 | 65K | |
| mysterious crash.spc | 2019-08-17 06:50 | 65K | |
| mu training.spc | 2019-08-17 06:50 | 65K | |
| morning in the desert.spc | 2019-08-17 06:50 | 65K | |
| moonside swing.spc | 2019-08-17 06:50 | 65K | |
| megaton walk.spc | 2019-08-17 06:50 | 65K | |
| mechanical tinkering.spc | 2019-08-17 06:50 | 65K | |
| master of the stars.spc | 2019-08-17 06:50 | 65K | |
| magic butterfly.spc | 2019-08-17 06:50 | 65K | |
| lava springs.spc | 2019-08-17 06:50 | 65K | |
| kraken of the sea.spc | 2019-08-17 06:50 | 65K | |
| key item fanfare.spc | 2019-08-17 06:50 | 65K | |
| in winters, there is a genius.spc | 2019-08-17 06:50 | 65K | |
| inside the dungeon.spc | 2019-08-17 06:50 | 65K | |
| in dalaam, there is a warrior.spc | 2019-08-17 06:50 | 65K | |
| hospital.spc | 2019-08-17 06:50 | 65K | |
| home sweet home.spc | 2019-08-17 06:50 | 65K | |
| hi hi hi.spc | 2019-08-17 06:50 | 65K | |
| hidden track.spc | 2019-08-17 06:50 | 65K | |
| heartless hotel.spc | 2019-08-17 06:50 | 65K | |
| happy-happy is blue.spc | 2019-08-17 06:50 | 65K | |
| good friends, bad friends.spc | 2019-08-17 06:50 | 65K | |
| going down!.spc | 2019-08-17 06:50 | 65K | |
| giygas stirs.spc | 2019-08-17 06:50 | 65K | |
| giygas is wounded!.spc | 2019-08-17 06:50 | 65K | |
| giygas is fatally wounded!.spc | 2019-08-17 06:50 | 65K | |
| giygas disintegrates.spc | 2019-08-17 06:50 | 65K | |
| giygas' static.spc | 2019-08-17 06:50 | 65K | |
| giygas' lair.spc | 2019-08-17 06:50 | 65K | |
| giygas' intro.spc | 2019-08-17 06:50 | 65K | |
| giygas' intimidation.spc | 2019-08-17 06:50 | 65K | |
| get on the bus.spc | 2019-08-17 06:50 | 65K | |
| friendly neighbors.spc | 2019-08-17 06:50 | 65K | |
| franky.spc | 2019-08-17 06:50 | 65K | |
| flowing water.spc | 2019-08-17 06:50 | 65K | |
| falling underground!.spc | 2019-08-17 06:50 | 65K | |
| evil mani mani statue.spc | 2019-08-17 06:50 | 65K | |
| escargo express at your service!.spc | 2019-08-17 06:50 | 65K | |
| enjoy your stay.spc | 2019-08-17 06:50 | 65K | |
| eight melodies.spc | 2019-08-17 06:50 | 65K | |
| drilling.spc | 2019-08-17 06:50 | 65K | |
| dr. andonuts' lab.spc | 2019-08-17 06:50 | 65K | |
| deeper into ness' subconscious.spc | 2019-08-17 06:50 | 65K | |
| dead-end chaos theatre.spc | 2019-08-17 06:50 | 65K | |
| dangerous caves.spc | 2019-08-17 06:50 | 65K | |
| choose a file.spc | 2019-08-17 06:50 | 65K | |
| caverns of winters.spc | 2019-08-17 06:50 | 65K | |
| buzz buzz's prophecy.spc | 2019-08-17 06:50 | 65K | |
| buzz buzz's demise.spc | 2019-08-17 06:50 | 65K | |
| buy somethin' will ya!.spc | 2019-08-17 06:50 | 65K | |
| burp.spc | 2019-08-17 06:50 | 65K | |
| boy meets girl.spc | 2019-08-17 06:50 | 65K | |
| boris' cocktail.spc | 2019-08-17 06:50 | 65K | |
| belch's factory.spc | 2019-08-17 06:50 | 65K | |
| bed and breakfast.spc | 2019-08-17 06:50 | 65K | |
| because i love you.spc | 2019-08-17 06:50 | 65K | |
| bazaar.spc | 2019-08-17 06:50 | 65K | |
| battle against belch.spc | 2019-08-17 06:50 | 65K | |
| battle against a weird opponent.spc | 2019-08-17 06:50 | 65K | |
| battle against a weak opponent.spc | 2019-08-17 06:50 | 65K | |
| battle against an unsettling opponent.spc | 2019-08-17 06:50 | 65K | |
| battle against a mobile opponent.spc | 2019-08-17 06:50 | 65K | |
| battle against a machine.spc | 2019-08-17 06:50 | 65K | |
| bad morning to you.spc | 2019-08-17 06:50 | 65K | |
| apple kid's theme.spc | 2019-08-17 06:50 | 65K | |
| ambush!.spc | 2019-08-17 06:50 | 65K | |
| alien invasion 2.spc | 2019-08-17 06:50 | 65K | |
| alien invasion 1.spc | 2019-08-17 06:50 | 65K | |
| a good night's rest.spc | 2019-08-17 06:50 | 65K | |
| a good buddy.spc | 2019-08-17 06:50 | 65K | |
| a flash of memory.spc | 2019-08-17 06:50 | 65K | |
| a bad dream.spc | 2019-08-17 06:50 | 65K | |
|
|---|