![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/unknown.gif) | big crunch.it | 2008-07-04 14:04 | 662K | |
| bottleneckmelon.it | 2008-07-04 14:05 | 1.6M | |
| cheap music.it | 2008-07-04 14:05 | 44K | |
| chemical love store.it | 2008-07-04 14:05 | 1.1M | |
| deaf & blind.it | 2008-07-04 14:05 | 102K | |
| dirty upskirt.it | 2008-07-04 14:05 | 1.0M | |
| dog slaughter.it | 2008-07-04 14:05 | 363K | |
| faces, polygons.it | 2008-07-04 14:05 | 135K | |
| flixotide (epifenol mix).it | 2008-07-04 14:05 | 689K | |
| flixotide (kuol.viljaa).it | 2008-07-04 14:05 | 411K | |
| flixotide (mthee.21).it | 2008-07-04 14:05 | 168K | |
| flixotide (neumanidol).it | 2008-07-04 14:05 | 196K | |
| gnab gib.it | 2008-07-04 14:05 | 1.1M | |
| heat from the street.it | 2008-07-04 14:05 | 912K | |
| herb song.it | 2008-07-04 14:05 | 198K | |
| i know i leak.it | 2008-07-04 14:05 | 387K | |
| inspector c.it | 2008-07-04 14:06 | 2.0M | |
| intro.it | 2008-07-04 14:06 | 31K | |
| its not time to play.it | 2008-07-04 14:06 | 2.2M | |
| i wanna be a chippie.it | 2008-07-04 14:05 | 18K | |
| jean nine - de la funk.it | 2008-07-04 14:06 | 1.2M | |
| kangasala beats.it | 2008-07-04 14:06 | 14K | |
| kapitalistipaska.it | 2008-07-04 14:06 | 184K | |
| lemonapplet beautiful.it | 2008-07-04 14:06 | 1.5M | |
| lobo's adventures.it | 2008-07-04 14:07 | 661K | |
| look at here (8-bit).it | 2008-07-04 14:07 | 719K | |
| mandal shakana.it | 2008-07-04 14:07 | 532K | |
| moonshine with sunshine.it | 2008-07-04 14:07 | 1.0M | |
| phalaw love-16bit.it | 2008-07-04 14:07 | 1.8M | |
| roskaruokala.it | 2008-07-04 14:07 | 188K | |
| ruoskaa kansalle.it | 2008-07-04 14:07 | 120K | |
| sadonkorjuu.it | 2008-07-04 14:07 | 126K | |
| saxophone charlie.it | 2008-07-04 14:07 | 1.2M | |
| shantal morning.it | 2008-07-04 14:07 | 259K | |
| shina teenpop.it | 2008-07-04 14:07 | 724K | |
| son of the robottimies.it | 2008-07-04 14:07 | 16K | |
| starcake lounge.it | 2008-07-04 14:07 | 21K | |
| take this robot.it | 2008-07-04 14:07 | 43K | |
| terror in kalvia.it | 2008-07-04 14:07 | 18K | |
| the french love.it | 2008-07-04 14:07 | 1.1M | |
| the murder funk.it | 2008-07-04 14:08 | 1.6M | |
| the only one like u.it | 2008-07-04 14:08 | 1.6M | |
| thru the days i walk.it | 2008-07-04 14:08 | 1.2M | |
| vaisala beats.it | 2008-07-04 14:08 | 666K | |
| wandaskeem01.it | 2008-07-04 14:08 | 1.5M | |
| wendy.it | 2008-07-04 14:09 | 1.0M | |
| weslayyouwithourorders.it | 2008-07-04 14:09 | 454K | |
| white coffee.it | 2008-07-04 14:09 | 1.4M | |
|
|---|