![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/unknown.gif) | a girl in berlin.it | 2008-07-04 07:29 | 879K | |
| airwave melodic research.it | 2008-07-04 07:30 | 1.6M | |
| airwave the basic's.it | 2018-01-02 16:01 | 2.0M | |
| a night in france.it | 2008-07-04 07:29 | 1.9M | |
| chain reaction.it | 2018-01-02 16:01 | 1.0M | |
![[DIR]](/icons/folder.gif) | coop-DJ Spikey/ | 2008-07-04 07:31 | - | |
| dance with the dj.it | 2008-07-04 07:30 | 1.5M | |
| deep sinx.it | 2018-01-02 16:01 | 668K | |
| dj kneh's airwave stings.it | 2008-07-04 07:30 | 1.3M | |
| for a new day.it | 2018-01-02 16:01 | 423K | |
| free of mind.it | 2018-01-02 16:01 | 1.1M | |
| guhyasamja vtx.it | 2008-07-04 07:30 | 853K | |
| hotel california.it | 2018-01-02 16:01 | 546K | |
| how much i like you.it | 2018-01-02 16:01 | 1.1M | |
| of the world.it | 2018-01-02 16:01 | 742K | |
| orbit urgent.it | 2008-07-04 07:30 | 821K | |
| shubbing (icgh-edit).it | 2018-01-02 16:01 | 1.0M | |
| shubbing.it | 2018-01-02 16:01 | 568K | |
| so good.it | 2008-07-04 07:30 | 382K | |
| stay close.it | 2008-07-04 07:30 | 795K | |
| the house of my soul.it | 2008-07-04 07:30 | 464K | |
| the nova scotia.it | 2008-07-04 07:30 | 481K | |
| the real dream.it | 2018-01-02 16:01 | 1.2M | |
| the theme of dance.it | 2008-07-04 07:31 | 1.1M | |
| this is my dream k.it | 2018-01-02 16:01 | 1.6M | |
| trance journey.it | 2018-01-02 16:01 | 1.0M | |
| waves of eternity k.it | 2018-01-02 16:01 | 578K | |
| when i'am thinking.it | 2018-01-02 16:01 | 881K | |
|
|---|