![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/unknown.gif) | akaledureduzaphobia.it | 2019-03-23 08:07 | 100K | |
![[ ]](/icons/unknown.gif) | all that glitters.it | 2008-07-04 02:41 | 268K | |
![[ ]](/icons/unknown.gif) | another of the same.it | 2008-07-04 02:42 | 517K | |
![[ ]](/icons/unknown.gif) | antidepressants.it | 2008-07-04 02:42 | 155K | |
![[ ]](/icons/unknown.gif) | borrowed time.it | 2008-07-04 02:42 | 376K | |
![[ ]](/icons/unknown.gif) | borrowed time otsafhb remix.it | 2019-03-23 08:07 | 1.6M | |
![[ ]](/icons/unknown.gif) | carol of the bells remix.it | 2008-07-04 02:42 | 1.9M | |
![[ ]](/icons/unknown.gif) | chemical imbalance.it | 2008-07-04 02:42 | 1.1M | |
![[ ]](/icons/unknown.gif) | come with me.it | 2008-07-04 02:42 | 355K | |
![[DIR]](/icons/folder.gif) | coop-Phil Brown/ | 2008-07-04 02:45 | - | |
![[DIR]](/icons/folder.gif) | coop-Thorn/ | 2021-04-24 06:39 | - | |
![[ ]](/icons/unknown.gif) | crapola guacamolisimo!.it | 2019-03-23 08:07 | 171K | |
![[ ]](/icons/unknown.gif) | del rio.it | 2008-07-04 02:42 | 145K | |
![[ ]](/icons/unknown.gif) | discoloration.it | 2008-07-04 02:42 | 84K | |
![[ ]](/icons/unknown.gif) | for a moment.it | 2008-07-04 02:42 | 599K | |
![[ ]](/icons/unknown.gif) | forgotten.it | 2008-07-04 02:42 | 1.1M | |
![[ ]](/icons/unknown.gif) | fur elise remix.it | 2008-07-04 02:42 | 307K | |
![[ ]](/icons/unknown.gif) | ginga.it | 2008-07-04 02:42 | 300K | |
![[ ]](/icons/unknown.gif) | gravity.it | 2008-07-04 02:42 | 150K | |
![[ ]](/icons/unknown.gif) | impromptu.it | 2008-07-04 02:43 | 712K | |
![[ ]](/icons/unknown.gif) | influences.it | 2008-07-04 02:43 | 156K | |
![[ ]](/icons/unknown.gif) | intricacies.it | 2008-07-04 02:43 | 646K | |
![[ ]](/icons/unknown.gif) | jessika.it | 2008-07-04 02:43 | 504K | |
![[ ]](/icons/unknown.gif) | living score.it | 2008-07-04 02:43 | 2.7M | |
![[ ]](/icons/unknown.gif) | memphis nights.it | 2008-07-04 02:43 | 350K | |
![[ ]](/icons/unknown.gif) | merkal.it | 2008-07-04 02:43 | 289K | |
![[ ]](/icons/unknown.gif) | modarchive theme compo.it | 2019-03-23 08:07 | 431K | |
![[ ]](/icons/unknown.gif) | my little trip.it | 2019-03-23 08:07 | 520K | |
![[ ]](/icons/unknown.gif) | panda.it | 2008-07-04 02:43 | 390K | |
![[ ]](/icons/unknown.gif) | passion.it | 2008-07-04 02:43 | 659K | |
![[ ]](/icons/unknown.gif) | perceptions of reality.it | 2019-03-23 08:07 | 266K | |
![[ ]](/icons/unknown.gif) | piano concerto in a-major.it | 2019-03-23 08:07 | 298K | |
![[ ]](/icons/unknown.gif) | piano concerto in c-minor (part 2).it | 2019-03-23 08:07 | 288K | |
![[ ]](/icons/unknown.gif) | piano concerto in c-minor.it | 2019-03-23 08:07 | 230K | |
![[ ]](/icons/unknown.gif) | piano concerto in g-major.it | 2019-03-23 08:07 | 242K | |
![[ ]](/icons/unknown.gif) | popcorn-azo mix.it | 2008-07-04 02:43 | 232K | |
![[ ]](/icons/unknown.gif) | remix of mind.it | 2008-07-04 02:43 | 116K | |
![[ ]](/icons/unknown.gif) | return to lothloria.it | 2008-07-04 02:44 | 763K | |
![[ ]](/icons/unknown.gif) | seduction.it | 2008-07-04 02:44 | 504K | |
![[ ]](/icons/unknown.gif) | september.it | 2008-07-04 02:44 | 173K | |
![[ ]](/icons/unknown.gif) | serenegoh suite.it | 2008-07-04 02:44 | 808K | |
![[ ]](/icons/unknown.gif) | slight of mind.it | 2008-07-04 02:44 | 126K | |
![[ ]](/icons/unknown.gif) | sonata #8 (patetica).it | 2019-03-23 08:07 | 204K | |
![[ ]](/icons/unknown.gif) | sonora.it | 2008-07-04 02:44 | 1.1M | |
![[ ]](/icons/unknown.gif) | sorrow.it | 2008-07-04 02:44 | 404K | |
![[ ]](/icons/unknown.gif) | stormy sunday.it | 2008-07-04 02:44 | 158K | |
![[ ]](/icons/unknown.gif) | super patterns #1.it | 2019-03-23 08:07 | 226K | |
![[ ]](/icons/unknown.gif) | telemundo!.it | 2019-03-23 08:07 | 113K | |
![[ ]](/icons/unknown.gif) | the sans angel.it | 2008-07-04 02:44 | 277K | |
![[ ]](/icons/unknown.gif) | thirteen.it | 2008-07-04 02:44 | 4.2M | |
![[ ]](/icons/unknown.gif) | two sketches-lead & ink.it | 2008-07-04 02:44 | 415K | |
![[ ]](/icons/unknown.gif) | until the last.it | 2008-07-04 02:44 | 150K | |
![[ ]](/icons/unknown.gif) | upon a time.it | 2008-07-04 02:44 | 249K | |
![[ ]](/icons/unknown.gif) | welcome to the menu.it | 2008-07-04 02:45 | 299K | |
![[ ]](/icons/unknown.gif) | when truth be told (iii).it | 2008-07-04 02:45 | 1.5M | |
|