![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| (leggematter'n)mix.xm | 2008-07-03 16:20 | 706K | |
| all alone, fucked up.xm | 2008-07-03 16:20 | 541K | |
| big grape.xm | 2008-07-03 16:20 | 366K | |
| champagne brus.xm | 2008-07-03 16:20 | 286K | |
| chemical reaction.xm | 2008-07-03 16:20 | 108K | |
| electronic waste.xm | 2008-07-03 16:20 | 764K | |
| elvis presley.xm | 2008-07-03 16:20 | 1.3M | |
| fitte.xm | 2008-07-03 16:20 | 1.3M | |
| fuckin' pain bwoy.xm | 2008-07-03 16:20 | 687K | |
| funky shit.xm | 2008-07-03 16:20 | 607K | |
| g-force mania wrap.xm | 2008-07-03 16:20 | 185K | |
| hip hop luka.xm | 2008-07-03 16:20 | 783K | |
| hymn to others.xm | 2008-07-03 16:20 | 74K | |
| jailbird.xm | 2008-07-03 16:20 | 1.0M | |
| jungl'in the dark.xm | 2008-07-03 16:20 | 313K | |
| kraftwerk.xm | 2008-07-03 16:20 | 1.3M | |
| legalize - sub zero.xm | 2008-07-03 16:20 | 778K | |
| minefields.xm | 2008-07-03 16:20 | 523K | |
| nice work.xm | 2008-07-03 16:20 | 312K | |
| on the edge.xm | 2008-07-03 16:20 | 410K | |
| perminalen.xm | 2008-07-03 16:20 | 111K | |
| pique nique arts.xm | 2008-07-03 16:20 | 91K | |
| poison.xm | 2008-07-03 16:21 | 462K | |
| public enemy.xm | 2008-07-03 16:21 | 647K | |
| raaaape.xm | 2008-07-03 16:21 | 185K | |
| release the pressure.xm | 2008-07-03 16:21 | 260K | |
| rockon mix.xm | 2008-07-03 16:21 | 580K | |
| spouzerbarbara.xm | 2008-07-03 16:21 | 219K | |
| suppe & lok.xm | 2018-01-02 15:55 | 676K | |
| tor erik larsen mix.xm | 2008-07-03 16:21 | 363K | |
| trawabalash.xm | 2008-07-03 16:21 | 245K | |
| trip on sid.xm | 2008-07-03 16:21 | 430K | |
| twisting samples.xm | 2008-07-03 16:21 | 749K | |
| voodoo people.xm | 2008-07-03 16:21 | 547K | |
| we eat rythm.xm | 2008-07-03 16:21 | 342K | |