![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| beats of trash.xm | 2008-07-02 15:01 | 240K | |
| f0r drugman's.xm | 2008-07-02 15:01 | 378K | |
| frozen horizont.xm | 2008-07-02 15:01 | 1.3M | |
| goat.xm | 2008-07-02 15:01 | 265K | |
| hbg & alcogol.xm | 2008-07-02 15:01 | 1.1M | |
| heavy lyrics.xm | 2008-07-02 15:01 | 299K | |
| ice drug.xm | 2008-07-02 15:01 | 347K | |
| is gone.xm | 2008-07-02 15:01 | 546K | |
| jump from the fire.xm | 2008-07-02 15:01 | 448K | |
| konechnyi rezultat.xm | 2008-07-02 15:01 | 350K | |
| manufuckturi dance.xm | 2008-07-02 15:01 | 428K | |
| peice of beats.xm | 2008-07-02 15:01 | 573K | |
| rate.xm | 2008-07-02 15:01 | 421K | |
| revolution.xm | 2008-07-02 15:01 | 556K | |
| she.xm | 2008-07-02 15:01 | 279K | |
| virus.xm | 2008-07-02 15:01 | 233K | |
| why you d't call me.xm | 2008-07-02 15:02 | 424K | |