![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/unknown.gif) | gunbird1.psf2lib | 2018-01-07 10:42 | 292K | |
| gunbird1 01 - discover the dream.psf2 | 2018-01-07 10:42 | 1.3K | |
| gunbird1 02 - backstar's fortress.psf2 | 2018-01-07 10:42 | 2.2K | |
| gunbird1 03 - chase the case.psf2 | 2018-01-07 10:42 | 1.7K | |
| gunbird1 04 - pointed square.psf2 | 2018-01-07 10:42 | 3.3K | |
| gunbird1 05 - trick trump train.psf2 | 2018-01-07 10:42 | 3.1K | |
| gunbird1 06 - shot in the underground.psf2 | 2018-01-07 10:42 | 3.6K | |
| gunbird1 07 - high energy.psf2 | 2018-01-07 10:42 | 1.8K | |
| gunbird1 08 - we did it.psf2 | 2018-01-07 10:42 | 1.2K | |
| gunbird1 09 - aqua blue.psf2 | 2018-01-07 10:42 | 3.6K | |
| gunbird1 10 - unknown objects.psf2 | 2018-01-07 10:42 | 2.6K | |
| gunbird1 11 - mistery circle.psf2 | 2018-01-07 10:42 | 3.7K | |
| gunbird1 12 - the trap - from the ancient.psf2 | 2018-01-07 10:42 | 2.7K | |
| gunbird1 13 - reborn.psf2 | 2018-01-07 10:42 | 2.9K | |
| gunbird1 14 - the end of gunbird a.psf2 | 2018-01-07 10:42 | 922 | |
| gunbird1 15 - the end of gunbird b.psf2 | 2018-01-07 10:42 | 948 | |
| gunbird1 16 - the end of gunbird c.psf2 | 2018-01-07 10:42 | 673 | |
| gunbird1 17 - the end of gunbird d.psf2 | 2018-01-07 10:42 | 691 | |
| gunbird1 18 - dreamin' again.psf2 | 2018-01-07 10:42 | 933 | |
| gunbird2.psf2lib | 2018-01-07 10:42 | 201K | |
| gunbird2 01 - discover the dream.psf2 | 2018-01-07 10:42 | 1.3K | |
| gunbird2 02 - just fly, the dreamers.psf2 | 2018-01-07 10:42 | 3.3K | |
| gunbird2 03 - chase the case.psf2 | 2018-01-07 10:42 | 1.6K | |
| gunbird2 04 - type of essence.psf2 | 2018-01-07 10:42 | 2.8K | |
| gunbird2 05 - why do you wanna fly.psf2 | 2018-01-07 10:42 | 3.3K | |
| gunbird2 06 - gunbird.psf2 | 2018-01-07 10:42 | 3.5K | |
| gunbird2 07 - high energy.psf2 | 2018-01-07 10:42 | 1.7K | |
| gunbird2 08 - we did it.psf2 | 2018-01-07 10:42 | 1.0K | |
| gunbird2 09 - high speed reaction (trick tramp train).psf2 | 2018-01-07 10:42 | 2.7K | |
| gunbird2 10 - a cold new world.psf2 | 2018-01-07 10:42 | 2.7K | |
| gunbird2 11 - a minute to midnight.psf2 | 2018-01-07 10:42 | 1.3K | |
| gunbird2 12 - feel bad.psf2 | 2018-01-07 10:42 | 1.1K | |
| gunbird2 13 - unbelievable zone.psf2 | 2018-01-07 10:42 | 1.0K | |
| gunbird2 14 - the end of gunbird e.psf2 | 2018-01-07 10:42 | 1.1K | |
| gunbird2 15 - the end of gunbird f.psf2 | 2018-01-07 10:42 | 748 | |
| gunbird2 16 - dreamin' again.psf2 | 2018-01-07 10:42 | 903 | |
![[TXT]](/icons/text.gif) | readme.txt | 2018-01-07 10:42 | 389 | |
|
|---|