![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/unknown.gif) | Autch - Final Fantasy (Opening).pmd | 2018-01-07 10:31 | 474 | |
![[ ]](/icons/unknown.gif) | Autch - Final Fantasy (Prelude).pmd | 2018-01-07 10:31 | 594 | |
![[DIR]](/icons/folder.gif) | Autch/ | 2018-01-07 10:31 | - | |
![[ ]](/icons/unknown.gif) | Chemool - 99, Summer.pmd | 2018-01-07 10:31 | 2.3K | |
![[ ]](/icons/unknown.gif) | Chemool - Bewitched Slave.pmd | 2018-01-07 10:31 | 665 | |
![[ ]](/icons/unknown.gif) | Chemool - Calling.pmd | 2018-01-07 10:31 | 600 | |
![[ ]](/icons/unknown.gif) | Chemool - Emotional Flame.pmd | 2018-01-07 10:31 | 3.0K | |
![[ ]](/icons/unknown.gif) | Chemool - Gymnopedies '92.pmd | 2018-01-07 10:31 | 1.3K | |
![[ ]](/icons/unknown.gif) | Chemool - Ki Taru Beki Ashita.pmd | 2018-01-07 10:31 | 1.2K | |
![[ ]](/icons/unknown.gif) | Chemool - Legendary Wings.pmd | 2018-01-07 10:31 | 2.4K | |
![[ ]](/icons/unknown.gif) | Chemool - Luck and Pluck.pmd | 2018-01-07 10:31 | 1.7K | |
![[ ]](/icons/unknown.gif) | Chemool - Meditationt.pmd | 2018-01-07 10:31 | 762 | |
![[ ]](/icons/unknown.gif) | Chemool - Shooting Beast.pmd | 2018-01-07 10:31 | 1.4K | |
![[ ]](/icons/unknown.gif) | Chemool - Tonsou no Rapusodii.pmd | 2018-01-07 10:31 | 1.8K | |
![[ ]](/icons/unknown.gif) | Chemool - Uniimei no Yume.pmd | 2018-01-07 10:31 | 1.2K | |
![[DIR]](/icons/folder.gif) | Chemool/ | 2018-01-07 10:31 | - | |
![[ ]](/icons/unknown.gif) | MKT - Blue Blaze.pmd | 2018-01-07 10:31 | 1.4K | |
![[ ]](/icons/unknown.gif) | MKT - Land of Oblivion.pmd | 2018-01-07 10:31 | 1.8K | |
![[ ]](/icons/unknown.gif) | MKT - Trans.pmd | 2018-01-07 10:31 | 1.6K | |
![[DIR]](/icons/folder.gif) | MKT/ | 2018-01-07 10:31 | - | |
![[DIR]](/icons/folder.gif) | Unknown/ | 2018-01-07 10:31 | - | |
![[ ]](/icons/unknown.gif) | Yama - Action Beat.pmd | 2018-01-07 10:31 | 1.0K | |
![[ ]](/icons/unknown.gif) | Yama - Dragon Slayer IV (Meia's Theme).pmd | 2018-01-07 10:31 | 2.0K | |
![[ ]](/icons/unknown.gif) | Yama - Dragon Slayer IV (Riruru's Theme).pmd | 2018-01-07 10:31 | 905 | |
![[ ]](/icons/unknown.gif) | Yama - Dragon Slayer IV (Zemun's Theme).pmd | 2018-01-07 10:31 | 1.2K | |
![[ ]](/icons/unknown.gif) | Yama - Glitter Sky.pmd | 2018-01-07 10:31 | 1.1K | |
![[ ]](/icons/unknown.gif) | Yama - Metalman 2 (Flashman Stage).pmd | 2018-01-07 10:31 | 1.7K | |
![[ ]](/icons/unknown.gif) | Yama - Rockman 2 (Airman Stage).pmd | 2018-01-07 10:31 | 1.8K | |
![[ ]](/icons/unknown.gif) | Yama - Rockman 2 (Flashman Stage).pmd | 2018-01-07 10:31 | 1.6K | |
![[ ]](/icons/unknown.gif) | Yama - Sample BGM 1.pmd | 2018-01-07 10:31 | 822 | |
![[ ]](/icons/unknown.gif) | Yama - Sample BGM 2.pmd | 2018-01-07 10:31 | 1.2K | |
![[ ]](/icons/unknown.gif) | Yama - Sample BGM 3.pmd | 2018-01-07 10:31 | 885 | |
![[ ]](/icons/unknown.gif) | Yama - Shinobu to Yakyuu Ken (BGM 1).pmd | 2018-01-07 10:31 | 594 | |
![[ ]](/icons/unknown.gif) | Yama - Shinobu to Yakyuu Ken (BGM 2).pmd | 2018-01-07 10:31 | 625 | |
![[ ]](/icons/unknown.gif) | Yama - Shinobu to Yakyuu Ken (BGM 3).pmd | 2018-01-07 10:31 | 881 | |
![[ ]](/icons/unknown.gif) | Yama - Triangle Heart (Pop'n Wind).pmd | 2018-01-07 10:31 | 1.0K | |
![[ ]](/icons/unknown.gif) | Yama - Triangle Heart (Thoughts into Play).pmd | 2018-01-07 10:31 | 699 | |
![[ ]](/icons/unknown.gif) | Yama - Twilight Moon.pmd | 2018-01-07 10:31 | 904 | |
![[DIR]](/icons/folder.gif) | Yama/ | 2018-01-07 10:31 | - | |
![[TXT]](/icons/text.gif) | [P-ECE]_P-ECE_Music_[PMD].txt | 2018-01-07 10:31 | 231 | |
|