![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/unknown.gif) | 01 - title screen.spc | 2020-03-07 04:02 | 65K | |
| 02 - introduction.spc | 2020-03-07 04:02 | 65K | |
| 03 - character select.spc | 2020-03-07 04:02 | 65K | |
| 04 - map screen.spc | 2020-03-07 04:02 | 65K | |
| 05 - prepare for the race.spc | 2020-03-07 04:02 | 65K | |
| 06 - get ready.spc | 2020-03-07 04:02 | 65K | |
| 07 - hebe's stage.spc | 2020-03-07 04:02 | 65K | |
| 08 - bonus race.spc | 2020-03-07 04:02 | 65K | |
| 09 - ouchan's stage.spc | 2020-03-07 04:02 | 65K | |
| 10 - sukezaemon's stage.spc | 2020-03-07 04:02 | 65K | |
| 11 - jenifer's stage.spc | 2020-03-07 04:02 | 65K | |
| 12 - booboodori and utsuzin's stage.spc | 2020-03-07 04:02 | 65K | |
| 13 - penchan's stage.spc | 2020-03-07 04:02 | 65K | |
| 14 - unyoon's stage.spc | 2020-03-07 04:02 | 65K | |
| 15 - race won.spc | 2020-03-07 04:02 | 65K | |
| 16 - race lost.spc | 2020-03-07 04:02 | 65K | |
| 17 - ending.spc | 2020-03-07 04:02 | 65K | |
| 18 - staff roll.spc | 2020-03-07 04:02 | 65K | |
| 19 - game over.spc | 2020-03-07 04:02 | 65K | |
| hashire!.spc | 2020-03-07 04:02 | 65K | |
| hebereke!.spc | 2020-03-07 04:02 | 65K | |
| ki ni tsuite!.spc | 2020-03-07 04:02 | 65K | |
| matane!.spc | 2020-03-07 04:02 | 65K | |
| unknown jingle 1.spc | 2020-03-07 04:02 | 65K | |
| unknown jingle 2.spc | 2020-03-07 04:02 | 65K | |
| unknown song.spc | 2020-03-07 04:02 | 65K | |
| yei!.spc | 2020-03-07 04:02 | 65K | |
| yoi....spc | 2020-03-07 04:02 | 65K | |
|
|---|