![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/unknown.gif) | 01 - opening.spc | 2020-03-07 04:01 | 65K | |
| 02 - main theme.spc | 2020-03-07 04:01 | 65K | |
| 03 - character select.spc | 2020-03-07 04:01 | 65K | |
| 04 - next mission.spc | 2020-03-07 04:01 | 65K | |
| 05 - dragon dojo exterior.spc | 2020-03-07 04:01 | 65K | |
| 06 - dragon dojo interior.spc | 2020-03-07 04:01 | 65K | |
| 07 - cody's nutron grill.spc | 2020-03-07 04:01 | 65K | |
| 08 - dusty's garage.spc | 2020-03-07 04:01 | 65K | |
| 09 - metro city hotel.spc | 2020-03-07 04:01 | 65K | |
| 10 - metro city sewer system.spc | 2020-03-07 04:01 | 65K | |
| 11 - chemical factory.spc | 2020-03-07 04:01 | 65K | |
| 12 - fusion plant exterior.spc | 2020-03-07 04:01 | 65K | |
| 13 - fusion plant interior.spc | 2020-03-07 04:01 | 65K | |
| 14 - shadow dungeon.spc | 2020-03-07 04:01 | 65K | |
| 15 - shadow dojo exterior.spc | 2020-03-07 04:01 | 65K | |
| 16 - shadow dojo interior.spc | 2020-03-07 04:01 | 65K | |
| 17 - end of the fight.spc | 2020-03-07 04:01 | 65K | |
|
|---|